Medical Terminology Roots (With Meanings and Examples)

A root (combining form) carries the core meaning of a medical term, usually naming a body part or system. These are the most common roots with meanings, examples, and the systems they belong to.

RootMeaningExamplesSystem
cardi(o)-heartcardiomegaly, carditisCardiology
angi(o)-vessel, ductangioplasty, angiographyCardiology
thromb(o)-clotthrombosis, thrombocytopeniaHematology
hem(o)-, hemat(o)-bloodhematoma, hemolysisHematology
encephal(o)-brainencephalopathy, encephalitisNeurology
neur(o)-nerveneuropathy, neuralgiaNeurology
my(o)-musclemyopathy, myocardialMusculoskeletal
arthr(o)-jointarthralgia, arthritisMusculoskeletal
oste(o)-boneosteoporosis, osteonecrosisMusculoskeletal
hepat(o)-liverhepatitis, hepatomegalyGastroenterology
gastr(o)-stomachgastroparesis, gastritisGastroenterology
enter(o)-intestineenteritis, enterocolitisGastroenterology
col(o)-, colon(o)-coloncolitis, colonoscopyGastroenterology
nephr(o)-kidneynephritis, nephrologyNephrology
cyst(o)-bladder, saccystitis, cystoscopyNephrology
pulmon(o)-lungpulmonary, pulmonitisPulmonology
bronch(o)-bronchusbronchitis, bronchospasmPulmonology
derm(a)-, dermat(o)-skindermatitis, dermatologyDermatology
ophthalm(o)-eyeophthalmology, ophthalmoplegiaSensory
ot(o)-earotitis, otoscopySensory
rhin(o)-noserhinitis, rhinoplastySensory
onc(o)-tumor, massoncology, oncogenesisPathology
cyt(o)-cellcytology, cytotoxicPathology
hist(o)-tissuehistology, histopathologyPathology
path(o)-disease, sufferingpathology, neuropathyPathology
lith(o)-stone, calculuslithiasis, lithotripsyNephrology
trache(o)-trachea, windpipetracheotomy, tracheitisPulmonology
cephal(o)-headcephalic, hydrocephalusNeurology

Explore More Medical Terminology

Frequently Asked Questions

What is a medical root word?

A root word names the core anatomical, physiological, or pathological subject of a medical term — usually a body part or system. Cardi (heart), nephr (kidney), hepat (liver), and neur (nerve) are common examples.

How many medical roots should I learn?

Roughly 150–200 roots cover the body's major systems. Mastering them unlocks thousands of compound terms because the same root combines with many prefixes and suffixes.

Why do some roots have a combining vowel?

Roots usually take an 'o' (sometimes 'i') when joined to another word part, called a combining form (e.g., cardi-o-megaly). The vowel makes pronunciation smoother and is dropped before a vowel-starting suffix (cardi-itis → carditis).

What's the difference between Greek and Latin roots in medicine?

Both are common. Greek roots typically describe disease and function (nephr-, hepat-, derm-); Latin roots describe anatomy in clinical contexts (ren-, hepatic-, cutane-). Many body parts have both Greek and Latin roots.

What are the most common medical root words?

Cardi (heart), pulmon/pneumon (lung), gastr (stomach), hepat (liver), nephr/ren (kidney), neur (nerve), oste (bone), my (muscle), derm (skin), and hem/hemat (blood) appear in the majority of clinical vocabulary.